C24H22N4O6 — CID 4944222
3-methyl-N-[4-[[2-(2-nitrophenoxy)propanoylamino]carbamoyl]phenyl]benzamide (PubChem CID 4944222) has the molecular formula C24H22N4O6 and a molecular weight of 462.46 g/mol. Its IUPAC name is 3-methyl-N-[4-[[2-(2-nitrophenoxy)propanoylamino]carbamoyl]phenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[[2-(2-nitrophenoxy)propanoylamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 4944222 |
| Molecular Formula | C24H22N4O6 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 3-methyl-N-[4-[[2-(2-nitrophenoxy)propanoylamino]carbamoyl]phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(C(=O)NNC(=O)C(C)Oc3ccccc3[N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C24H22N4O6/c1-15-6-5-7-18(14-15)23(30)25-19-12-10-17(11-13-19)24(31)27-26-22(29)16(2)34-21-9-4-3-8-20(21)28(32)33/h3-14,16H,1-2H3,(H,25,30)(H,26,29)(H,27,31) |
| InChIKey | VRCMTRLOBJBKCZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|