C30H27N3O4 — CID 4952004
3-methyl-N-[4-[[2-(4-phenylphenoxy)propanoylamino]carbamoyl]phenyl]benzamide (PubChem CID 4952004) has the molecular formula C30H27N3O4 and a molecular weight of 493.56 g/mol. Its IUPAC name is 3-methyl-N-[4-[[2-(4-phenylphenoxy)propanoylamino]carbamoyl]phenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[[2-(4-phenylphenoxy)propanoylamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 4952004 |
| Molecular Formula | C30H27N3O4 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 3-methyl-N-[4-[[2-(4-phenylphenoxy)propanoylamino]carbamoyl]phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(C(=O)NNC(=O)C(C)Oc3ccc(-c4ccccc4)cc3)cc2)c1 |
| InChI | InChI=1S/C30H27N3O4/c1-20-7-6-10-25(19-20)29(35)31-26-15-11-24(12-16-26)30(36)33-32-28(34)21(2)37-27-17-13-23(14-18-27)22-8-4-3-5-9-22/h3-19,21H,1-2H3,(H,31,35)(H,32,34)(H,33,36) |
| InChIKey | QICCNGAMMQHYIN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|