C23H23ClIN5O3 — CID 5431501
N-[(Z)-1-[3-[[(2R)-2-(4-chloro-2-methylphenoxy)propanoyl]amino]phenyl]ethylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide (PubChem CID 5431501) has the molecular formula C23H23ClIN5O3 and a molecular weight of 579.83 g/mol. Its IUPAC name is N-[(Z)-1-[3-[[(2R)-2-(4-chloro-2-methylphenoxy)propanoyl]amino]phenyl]ethylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[(Z)-1-[3-[[(2R)-2-(4-chloro-2-methylphenoxy)propanoyl]amino]phenyl]ethylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5431501 |
| Molecular Formula | C23H23ClIN5O3 |
| Molecular Weight | 579.83 g/mol |
| Exact Mass | 579.05 |
| IUPAC Name | N-[(Z)-1-[3-[[(2R)-2-(4-chloro-2-methylphenoxy)propanoyl]amino]phenyl]ethylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide |
| SMILES | C/C(=N/NC(=O)c1nn(C)cc1I)c1cccc(NC(=O)[C@@H](C)Oc2ccc(Cl)cc2C)c1 |
| InChI | InChI=1S/C23H23ClIN5O3/c1-13-10-17(24)8-9-20(13)33-15(3)22(31)26-18-7-5-6-16(11-18)14(2)27-28-23(32)21-19(25)12-30(4)29-21/h5-12,15H,1-4H3,(H,26,31)(H,28,32)/b27-14-/t15-/m1/s1 |
| InChIKey | XRLIOLIYGNOZLZ-NODVXYSWSA-N |
| XLogP | 4.55 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.83 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|