C15H16IN5O2 — CID 6341767
N-[(Z)-1-(4-acetamidophenyl)ethylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide (PubChem CID 6341767) has the molecular formula C15H16IN5O2 and a molecular weight of 425.23 g/mol. Its IUPAC name is N-[(Z)-1-(4-acetamidophenyl)ethylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[(Z)-1-(4-acetamidophenyl)ethylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 6341767 |
| Molecular Formula | C15H16IN5O2 |
| Molecular Weight | 425.23 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | N-[(Z)-1-(4-acetamidophenyl)ethylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(/C(C)=N\NC(=O)c2nn(C)cc2I)cc1 |
| InChI | InChI=1S/C15H16IN5O2/c1-9(11-4-6-12(7-5-11)17-10(2)22)18-19-15(23)14-13(16)8-21(3)20-14/h4-8H,1-3H3,(H,17,22)(H,19,23)/b18-9- |
| InChIKey | HEMXBHIHBREACL-NVMNQCDNSA-N |
| XLogP | 2.14 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|