C13H14N6O3 — CID 781433
N-[1-(4-acetamidophenyl)ethylideneamino]-4-amino-1,2,5-oxadiazole-3-carboxamide (PubChem CID 781433) has the molecular formula C13H14N6O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is N-[1-(4-acetamidophenyl)ethylideneamino]-4-amino-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | N-[1-(4-acetamidophenyl)ethylideneamino]-4-amino-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 781433 |
| Molecular Formula | C13H14N6O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[1-(4-acetamidophenyl)ethylideneamino]-4-amino-1,2,5-oxadiazole-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(C(C)=NNC(=O)c2nonc2N)cc1 |
| InChI | InChI=1S/C13H14N6O3/c1-7(9-3-5-10(6-4-9)15-8(2)20)16-17-13(21)11-12(14)19-22-18-11/h3-6H,1-2H3,(H2,14,19)(H,15,20)(H,17,21) |
| InChIKey | VOPVRAOGAXEPAD-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 135.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|