C22H28ClN11O4 — CID 90485013
4-amino-N-[(E)-1-[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]phenyl]ethylideneamino]-1,2,5-oxadiazole-3-carboxamide;hydrochloride (PubChem CID 90485013) has the molecular formula C22H28ClN11O4 and a molecular weight of 545.99 g/mol. Its IUPAC name is 4-amino-N-[(E)-1-[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]phenyl]ethylideneamino]-1,2,5-oxadiazole-3-carboxamide;hydrochloride.
| Compound Name | 4-amino-N-[(E)-1-[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]phenyl]ethylideneamino]-1,2,5-oxadiazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 90485013 |
| Molecular Formula | C22H28ClN11O4 |
| Molecular Weight | 545.99 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 4-amino-N-[(E)-1-[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]phenyl]ethylideneamino]-1,2,5-oxadiazole-3-carboxamide;hydrochloride |
| SMILES | C/C(=N\NC(=O)c1nonc1N)c1ccc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1.Cl |
| InChI | InChI=1S/C22H27N11O4.ClH/c1-14(28-29-19(34)17-18(23)31-37-30-17)15-2-4-16(5-3-15)24-20-25-21(32-6-10-35-11-7-32)27-22(26-20)33-8-12-36-13-9-33;/h2-5H,6-13H2,1H3,(H2,23,31)(H,29,34)(H,24,25,26,27);1H/b28-14+; |
| InChIKey | YOSUHIGMRQTZNC-KVQMOARXSA-N |
| XLogP | 0.83 |
| TPSA | 182.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.99 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|