C21H28N12O2 — CID 3100121
3-N-[1-[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]phenyl]ethylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 3100121) has the molecular formula C21H28N12O2 and a molecular weight of 480.54 g/mol. Its IUPAC name is 3-N-[1-[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]phenyl]ethylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[1-[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]phenyl]ethylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 3100121 |
| Molecular Formula | C21H28N12O2 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 3-N-[1-[4-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]phenyl]ethylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | CC(=NNc1nncn1N)c1ccc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C21H28N12O2/c1-15(28-30-21-29-23-14-33(21)22)16-2-4-17(5-3-16)24-18-25-19(31-6-10-34-11-7-31)27-20(26-18)32-8-12-35-13-9-32/h2-5,14H,6-13,22H2,1H3,(H,29,30)(H,24,25,26,27) |
| InChIKey | IKGJGIGNVBFGAX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 156.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|