C16H20BrN7O — CID 171980798
2-N-[(Z)-1-(4-bromophenyl)ethylideneamino]-4-N-methyl-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 171980798) has the molecular formula C16H20BrN7O and a molecular weight of 406.29 g/mol. Its IUPAC name is 2-N-[(Z)-1-(4-bromophenyl)ethylideneamino]-4-N-methyl-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(Z)-1-(4-bromophenyl)ethylideneamino]-4-N-methyl-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 171980798 |
| Molecular Formula | C16H20BrN7O |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-N-[(Z)-1-(4-bromophenyl)ethylideneamino]-4-N-methyl-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N/N=C(/C)c2ccc(Br)cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H20BrN7O/c1-11(12-3-5-13(17)6-4-12)22-23-15-19-14(18-2)20-16(21-15)24-7-9-25-10-8-24/h3-6H,7-10H2,1-2H3,(H2,18,19,20,21,23)/b22-11- |
| InChIKey | AQEUIFOQLYGELW-JJFYIABZSA-N |
| XLogP | 2.35 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|