C20H24BrN7O2 — CID 1000397
N-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-3-phenylprop-2-enehydrazonoyl bromide (PubChem CID 1000397) has the molecular formula C20H24BrN7O2 and a molecular weight of 474.36 g/mol. Its IUPAC name is N-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-3-phenylprop-2-enehydrazonoyl bromide.
| Compound Name | N-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-3-phenylprop-2-enehydrazonoyl bromide |
|---|---|
| PubChem CID | 1000397 |
| Molecular Formula | C20H24BrN7O2 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-3-phenylprop-2-enehydrazonoyl bromide |
| SMILES | BrC(C=Cc1ccccc1)=NNc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H24BrN7O2/c21-17(7-6-16-4-2-1-3-5-16)25-26-18-22-19(27-8-12-29-13-9-27)24-20(23-18)28-10-14-30-15-11-28/h1-7H,8-15H2,(H,22,23,24,26) |
| InChIKey | QEJRAQJWLWLEOF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|