C18H23N7O2 — CID 2849563
N-(benzylideneamino)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 2849563) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is N-(benzylideneamino)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(benzylideneamino)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 2849563 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-(benzylideneamino)-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | C(=NNc1nc(N2CCOCC2)nc(N2CCOCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C18H23N7O2/c1-2-4-15(5-3-1)14-19-23-16-20-17(24-6-10-26-11-7-24)22-18(21-16)25-8-12-27-13-9-25/h1-5,14H,6-13H2,(H,20,21,22,23) |
| InChIKey | QJDBLXONOSEDFY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|