C21H22IN7O — CID 56697446
4-N-benzyl-2-N-[(E)-(4-iodophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 56697446) has the molecular formula C21H22IN7O and a molecular weight of 515.36 g/mol. Its IUPAC name is 4-N-benzyl-2-N-[(E)-(4-iodophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-benzyl-2-N-[(E)-(4-iodophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 56697446 |
| Molecular Formula | C21H22IN7O |
| Molecular Weight | 515.36 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | 4-N-benzyl-2-N-[(E)-(4-iodophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Ic1ccc(/C=N/Nc2nc(NCc3ccccc3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C21H22IN7O/c22-18-8-6-17(7-9-18)15-24-28-20-25-19(23-14-16-4-2-1-3-5-16)26-21(27-20)29-10-12-30-13-11-29/h1-9,15H,10-14H2,(H2,23,25,26,27,28)/b24-15+ |
| InChIKey | HENWMRXJUNHCCC-BUVRLJJBSA-N |
| XLogP | 3.37 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|