C25H26ClN7O2 — CID 136694379
1-[[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]naphthalen-2-ol;hydrochloride (PubChem CID 136694379) has the molecular formula C25H26ClN7O2 and a molecular weight of 491.98 g/mol. Its IUPAC name is 1-[[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]naphthalen-2-ol;hydrochloride.
| Compound Name | 1-[[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]naphthalen-2-ol;hydrochloride |
|---|---|
| PubChem CID | 136694379 |
| Molecular Formula | C25H26ClN7O2 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 1-[[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]naphthalen-2-ol;hydrochloride |
| SMILES | Cl.Oc1ccc2ccccc2c1C=NNc1nc(NCc2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C25H25N7O2.ClH/c33-22-11-10-19-8-4-5-9-20(19)21(22)17-27-31-24-28-23(26-16-18-6-2-1-3-7-18)29-25(30-24)32-12-14-34-15-13-32;/h1-11,17,33H,12-16H2,(H2,26,28,29,30,31);1H |
| InChIKey | SYKLGQIVSVESQA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|