C22H22BrN7O3 — CID 3110848
4-N-benzyl-2-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 3110848) has the molecular formula C22H22BrN7O3 and a molecular weight of 512.37 g/mol. Its IUPAC name is 4-N-benzyl-2-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-benzyl-2-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3110848 |
| Molecular Formula | C22H22BrN7O3 |
| Molecular Weight | 512.37 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | 4-N-benzyl-2-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Brc1cc2c(cc1C=NNc1nc(NCc3ccccc3)nc(N3CCOCC3)n1)OCO2 |
| InChI | InChI=1S/C22H22BrN7O3/c23-17-11-19-18(32-14-33-19)10-16(17)13-25-29-21-26-20(24-12-15-4-2-1-3-5-15)27-22(28-21)30-6-8-31-9-7-30/h1-5,10-11,13H,6-9,12,14H2,(H2,24,26,27,28,29) |
| InChIKey | ODBWVOYCXCISMV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|