C22H25BrClN7O2 — CID 91962149
4-N-benzyl-2-N-[(2-bromo-5-methoxyphenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 91962149) has the molecular formula C22H25BrClN7O2 and a molecular weight of 534.85 g/mol. Its IUPAC name is 4-N-benzyl-2-N-[(2-bromo-5-methoxyphenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 4-N-benzyl-2-N-[(2-bromo-5-methoxyphenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 91962149 |
| Molecular Formula | C22H25BrClN7O2 |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | 4-N-benzyl-2-N-[(2-bromo-5-methoxyphenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | COc1ccc(Br)c(C=NNc2nc(NCc3ccccc3)nc(N3CCOCC3)n2)c1.Cl |
| InChI | InChI=1S/C22H24BrN7O2.ClH/c1-31-18-7-8-19(23)17(13-18)15-25-29-21-26-20(24-14-16-5-3-2-4-6-16)27-22(28-21)30-9-11-32-12-10-30;/h2-8,13,15H,9-12,14H2,1H3,(H2,24,26,27,28,29);1H |
| InChIKey | ABZVVNBZYODGLY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|