C21H22ClI2N7O2 — CID 136611939
2-[(E)-[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol;hydrochloride (PubChem CID 136611939) has the molecular formula C21H22ClI2N7O2 and a molecular weight of 693.72 g/mol. Its IUPAC name is 2-[(E)-[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol;hydrochloride.
| Compound Name | 2-[(E)-[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol;hydrochloride |
|---|---|
| PubChem CID | 136611939 |
| Molecular Formula | C21H22ClI2N7O2 |
| Molecular Weight | 693.72 g/mol |
| Exact Mass | 692.96 |
| IUPAC Name | 2-[(E)-[[4-(benzylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol;hydrochloride |
| SMILES | Cl.Oc1c(I)cc(I)cc1/C=N/Nc1nc(NCc2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H21I2N7O2.ClH/c22-16-10-15(18(31)17(23)11-16)13-25-29-20-26-19(24-12-14-4-2-1-3-5-14)27-21(28-20)30-6-8-32-9-7-30;/h1-5,10-11,13,31H,6-9,12H2,(H2,24,26,27,28,29);1H/b25-13+; |
| InChIKey | UYZRTMOWKAFPDN-FEIRLWDVSA-N |
| XLogP | 4.10 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|