C19H24IN7O3 — CID 137127262
2-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-iodo-6-methylphenol (PubChem CID 137127262) has the molecular formula C19H24IN7O3 and a molecular weight of 525.35 g/mol. Its IUPAC name is 2-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-iodo-6-methylphenol.
| Compound Name | 2-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-iodo-6-methylphenol |
|---|---|
| PubChem CID | 137127262 |
| Molecular Formula | C19H24IN7O3 |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | 2-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-iodo-6-methylphenol |
| SMILES | Cc1cc(I)cc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)c1O |
| InChI | InChI=1S/C19H24IN7O3/c1-13-10-15(20)11-14(16(13)28)12-21-25-17-22-18(26-2-6-29-7-3-26)24-19(23-17)27-4-8-30-9-5-27/h10-12,28H,2-9H2,1H3,(H,22,23,24,25)/b21-12- |
| InChIKey | ANZJQLDQWPKFPQ-MTJSOVHGSA-N |
| XLogP | 1.61 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|