C16H19I2N7O2 — CID 4525863
2-[[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol (PubChem CID 4525863) has the molecular formula C16H19I2N7O2 and a molecular weight of 595.18 g/mol. Its IUPAC name is 2-[[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol.
| Compound Name | 2-[[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 4525863 |
| Molecular Formula | C16H19I2N7O2 |
| Molecular Weight | 595.18 g/mol |
| Exact Mass | 594.97 |
| IUPAC Name | 2-[[[4-(dimethylamino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-diiodophenol |
| SMILES | CN(C)c1nc(NN=Cc2cc(I)cc(I)c2O)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H19I2N7O2/c1-24(2)15-20-14(21-16(22-15)25-3-5-27-6-4-25)23-19-9-10-7-11(17)8-12(18)13(10)26/h7-9,26H,3-6H2,1-2H3,(H,20,21,22,23) |
| InChIKey | NWCDZLKYSOBLNV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|