C21H21ClFI2N7O2 — CID 90486035
2-N-[(E)-(3,5-diiodo-2-methoxyphenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 90486035) has the molecular formula C21H21ClFI2N7O2 and a molecular weight of 711.70 g/mol. Its IUPAC name is 2-N-[(E)-(3,5-diiodo-2-methoxyphenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 2-N-[(E)-(3,5-diiodo-2-methoxyphenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 90486035 |
| Molecular Formula | C21H21ClFI2N7O2 |
| Molecular Weight | 711.70 g/mol |
| Exact Mass | 710.95 |
| IUPAC Name | 2-N-[(E)-(3,5-diiodo-2-methoxyphenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | COc1c(I)cc(I)cc1/C=N/Nc1nc(Nc2ccc(F)cc2)nc(N2CCOCC2)n1.Cl |
| InChI | InChI=1S/C21H20FI2N7O2.ClH/c1-32-18-13(10-15(23)11-17(18)24)12-25-30-20-27-19(26-16-4-2-14(22)3-5-16)28-21(29-20)31-6-8-33-9-7-31;/h2-5,10-12H,6-9H2,1H3,(H2,26,27,28,29,30);1H/b25-12+; |
| InChIKey | HZSKXMISMRGXBF-CYUVEUGNSA-N |
| XLogP | 4.68 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.70 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|