C16H19ClI2N6O3 — CID 90484652
N-[(E)-(3,5-diiodo-2-methoxyphenyl)methylideneamino]-4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-amine;hydrochloride (PubChem CID 90484652) has the molecular formula C16H19ClI2N6O3 and a molecular weight of 632.63 g/mol. Its IUPAC name is N-[(E)-(3,5-diiodo-2-methoxyphenyl)methylideneamino]-4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-amine;hydrochloride.
| Compound Name | N-[(E)-(3,5-diiodo-2-methoxyphenyl)methylideneamino]-4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 90484652 |
| Molecular Formula | C16H19ClI2N6O3 |
| Molecular Weight | 632.63 g/mol |
| Exact Mass | 631.93 |
| IUPAC Name | N-[(E)-(3,5-diiodo-2-methoxyphenyl)methylideneamino]-4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-amine;hydrochloride |
| SMILES | COc1nc(N/N=C/c2cc(I)cc(I)c2OC)nc(N2CCOCC2)n1.Cl |
| InChI | InChI=1S/C16H18I2N6O3.ClH/c1-25-13-10(7-11(17)8-12(13)18)9-19-23-14-20-15(22-16(21-14)26-2)24-3-5-27-6-4-24;/h7-9H,3-6H2,1-2H3,(H,20,21,22,23);1H/b19-9+; |
| InChIKey | NUBCWRLAQFKGSS-MYHMWQFYSA-N |
| XLogP | 2.80 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.63 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|