C19H23Br2N7O2 — CID 4168312
N-[(3,5-dibromo-2-methoxyphenyl)methylideneamino]-4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 4168312) has the molecular formula C19H23Br2N7O2 and a molecular weight of 541.25 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-methoxyphenyl)methylideneamino]-4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(3,5-dibromo-2-methoxyphenyl)methylideneamino]-4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 4168312 |
| Molecular Formula | C19H23Br2N7O2 |
| Molecular Weight | 541.25 g/mol |
| Exact Mass | 539.03 |
| IUPAC Name | N-[(3,5-dibromo-2-methoxyphenyl)methylideneamino]-4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | COc1c(Br)cc(Br)cc1C=NNc1nc(N2CCCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H23Br2N7O2/c1-29-16-13(10-14(20)11-15(16)21)12-22-26-17-23-18(27-4-2-3-5-27)25-19(24-17)28-6-8-30-9-7-28/h10-12H,2-9H2,1H3,(H,23,24,25,26) |
| InChIKey | ASHJMYILFFFFRC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|