C26H30BrN7O2 — CID 5105286
N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 5105286) has the molecular formula C26H30BrN7O2 and a molecular weight of 552.48 g/mol. Its IUPAC name is N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 5105286 |
| Molecular Formula | C26H30BrN7O2 |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Brc1ccc(OCc2ccccc2)c(C=NNc2nc(N3CCCCC3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C26H30BrN7O2/c27-22-9-10-23(36-19-20-7-3-1-4-8-20)21(17-22)18-28-32-24-29-25(33-11-5-2-6-12-33)31-26(30-24)34-13-15-35-16-14-34/h1,3-4,7-10,17-18H,2,5-6,11-16,19H2,(H,29,30,31,32) |
| InChIKey | LPBHIIZHHUKBIJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|