C25H28BrN7O — CID 3362135
N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 3362135) has the molecular formula C25H28BrN7O and a molecular weight of 522.45 g/mol. Its IUPAC name is N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3362135 |
| Molecular Formula | C25H28BrN7O |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | N-[(5-bromo-2-phenylmethoxyphenyl)methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Brc1ccc(OCc2ccccc2)c(C=NNc2nc(N3CCCC3)nc(N3CCCC3)n2)c1 |
| InChI | InChI=1S/C25H28BrN7O/c26-21-10-11-22(34-18-19-8-2-1-3-9-19)20(16-21)17-27-31-23-28-24(32-12-4-5-13-32)30-25(29-23)33-14-6-7-15-33/h1-3,8-11,16-17H,4-7,12-15,18H2,(H,28,29,30,31) |
| InChIKey | GGOBBBNNGOEBQH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|