C26H30FN7O2 — CID 94845090
N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 94845090) has the molecular formula C26H30FN7O2 and a molecular weight of 491.57 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 94845090 |
| Molecular Formula | C26H30FN7O2 |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | COc1cc(/C=N\Nc2nc(N3CCCC3)nc(N3CCCC3)n2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H30FN7O2/c1-35-23-16-20(8-11-22(23)36-18-19-6-9-21(27)10-7-19)17-28-32-24-29-25(33-12-2-3-13-33)31-26(30-24)34-14-4-5-15-34/h6-11,16-17H,2-5,12-15,18H2,1H3,(H,29,30,31,32)/b28-17- |
| InChIKey | HBCGKSPCIMXSRV-QRQIAZFYSA-N |
| XLogP | 4.24 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|