C29H30ClN7O2 — CID 50870632
2-N-[(E)-[3-[(4-chlorophenyl)methoxy]-4-methoxyphenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 50870632) has the molecular formula C29H30ClN7O2 and a molecular weight of 544.06 g/mol. Its IUPAC name is 2-N-[(E)-[3-[(4-chlorophenyl)methoxy]-4-methoxyphenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(E)-[3-[(4-chlorophenyl)methoxy]-4-methoxyphenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 50870632 |
| Molecular Formula | C29H30ClN7O2 |
| Molecular Weight | 544.06 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | 2-N-[(E)-[3-[(4-chlorophenyl)methoxy]-4-methoxyphenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(/C=N/Nc2nc(Nc3ccccc3)nc(N3CCCCC3)n2)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H30ClN7O2/c1-38-25-15-12-22(18-26(25)39-20-21-10-13-23(30)14-11-21)19-31-36-28-33-27(32-24-8-4-2-5-9-24)34-29(35-28)37-16-6-3-7-17-37/h2,4-5,8-15,18-19H,3,6-7,16-17,20H2,1H3,(H2,32,33,34,35,36)/b31-19+ |
| InChIKey | JLICEXYBMIXKDW-ZCTHSVRISA-N |
| XLogP | 6.29 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.06 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|