C28H28ClN7O — CID 3117575
2-N-[[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 3117575) has the molecular formula C28H28ClN7O and a molecular weight of 514.03 g/mol. Its IUPAC name is 2-N-[[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3117575 |
| Molecular Formula | C28H28ClN7O |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 2-N-[[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4-N-phenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Clc1ccc(COc2cccc(C=NNc3nc(Nc4ccccc4)nc(N4CCCCC4)n3)c2)cc1 |
| InChI | InChI=1S/C28H28ClN7O/c29-23-14-12-21(13-15-23)20-37-25-11-7-8-22(18-25)19-30-35-27-32-26(31-24-9-3-1-4-10-24)33-28(34-27)36-16-5-2-6-17-36/h1,3-4,7-15,18-19H,2,5-6,16-17,20H2,(H2,31,32,33,34,35) |
| InChIKey | OWCTYMXRMIMXOL-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|