C27H32ClN7O — CID 5340932
N-[(E)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 5340932) has the molecular formula C27H32ClN7O and a molecular weight of 506.05 g/mol. Its IUPAC name is N-[(E)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[(E)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 5340932 |
| Molecular Formula | C27H32ClN7O |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | N-[(E)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | Clc1ccccc1COc1cccc(/C=N/Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C27H32ClN7O/c28-24-13-4-3-11-22(24)20-36-23-12-9-10-21(18-23)19-29-33-25-30-26(34-14-5-1-6-15-34)32-27(31-25)35-16-7-2-8-17-35/h3-4,9-13,18-19H,1-2,5-8,14-17,20H2,(H,30,31,32,33)/b29-19+ |
| InChIKey | CFWVCCYIPUORLN-VUTHCHCSSA-N |
| XLogP | 5.53 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|