C31H35N7O2 — CID 3871763
N-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 3871763) has the molecular formula C31H35N7O2 and a molecular weight of 537.67 g/mol. Its IUPAC name is N-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3871763 |
| Molecular Formula | C31H35N7O2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | N-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCOc1cc(C=NNc2nc(N3CCCC3)nc(N3CCCC3)n2)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C31H35N7O2/c1-2-39-28-20-23(14-15-27(28)40-22-25-12-9-11-24-10-3-4-13-26(24)25)21-32-36-29-33-30(37-16-5-6-17-37)35-31(34-29)38-18-7-8-19-38/h3-4,9-15,20-21H,2,5-8,16-19,22H2,1H3,(H,33,34,35,36) |
| InChIKey | IHACGQYZFJNBDR-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|