C29H29Br2N7O3 — CID 50870526
N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 50870526) has the molecular formula C29H29Br2N7O3 and a molecular weight of 683.41 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 50870526 |
| Molecular Formula | C29H29Br2N7O3 |
| Molecular Weight | 683.41 g/mol |
| Exact Mass | 681.07 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | Brc1cc(/C=N/Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H29Br2N7O3/c30-24-16-20(17-25(31)26(24)41-19-22-6-3-5-21-4-1-2-7-23(21)22)18-32-36-27-33-28(37-8-12-39-13-9-37)35-29(34-27)38-10-14-40-15-11-38/h1-7,16-18H,8-15,19H2,(H,33,34,35,36)/b32-18+ |
| InChIKey | ASYACCWCYFSKDW-KCSSXMTESA-N |
| XLogP | 5.25 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|