C27H30Br2FN7O — CID 50870591
N-[(E)-[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 50870591) has the molecular formula C27H30Br2FN7O and a molecular weight of 647.39 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[(E)-[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 50870591 |
| Molecular Formula | C27H30Br2FN7O |
| Molecular Weight | 647.39 g/mol |
| Exact Mass | 645.09 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | Fc1ccc(COc2c(Br)cc(/C=N/Nc3nc(N4CCCCC4)nc(N4CCCCC4)n3)cc2Br)cc1 |
| InChI | InChI=1S/C27H30Br2FN7O/c28-22-15-20(16-23(29)24(22)38-18-19-7-9-21(30)10-8-19)17-31-35-25-32-26(36-11-3-1-4-12-36)34-27(33-25)37-13-5-2-6-14-37/h7-10,15-17H,1-6,11-14,18H2,(H,32,33,34,35)/b31-17+ |
| InChIKey | QBTNATLBTXFGSD-KBVAKVRCSA-N |
| XLogP | 6.54 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.39 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|