C22H23Br2ClFN7O — CID 73449375
2-N-[(3,5-dibromo-2-methoxyphenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 73449375) has the molecular formula C22H23Br2ClFN7O and a molecular weight of 615.73 g/mol. Its IUPAC name is 2-N-[(3,5-dibromo-2-methoxyphenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 2-N-[(3,5-dibromo-2-methoxyphenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 73449375 |
| Molecular Formula | C22H23Br2ClFN7O |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 613.00 |
| IUPAC Name | 2-N-[(3,5-dibromo-2-methoxyphenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | COc1c(Br)cc(Br)cc1C=NNc1nc(Nc2ccc(F)cc2)nc(N2CCCCC2)n1.Cl |
| InChI | InChI=1S/C22H22Br2FN7O.ClH/c1-33-19-14(11-15(23)12-18(19)24)13-26-31-21-28-20(27-17-7-5-16(25)6-8-17)29-22(30-21)32-9-3-2-4-10-32;/h5-8,11-13H,2-4,9-10H2,1H3,(H2,27,28,29,30,31);1H |
| InChIKey | JRLGZAQQWDITSI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|