C23H18Br2N8O3 — CID 171979391
2-N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 171979391) has the molecular formula C23H18Br2N8O3 and a molecular weight of 614.26 g/mol. Its IUPAC name is 2-N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 171979391 |
| Molecular Formula | C23H18Br2N8O3 |
| Molecular Weight | 614.26 g/mol |
| Exact Mass | 611.99 |
| IUPAC Name | 2-N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1c(Br)cc(Br)cc1/C=N/Nc1nc(Nc2ccccc2)nc(Nc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C23H18Br2N8O3/c1-36-20-14(11-15(24)12-19(20)25)13-26-32-23-30-21(27-16-5-3-2-4-6-16)29-22(31-23)28-17-7-9-18(10-8-17)33(34)35/h2-13H,1H3,(H3,27,28,29,30,31,32)/b26-13+ |
| InChIKey | AJFZLMPNMVPDSS-LGJNPRDNSA-N |
| XLogP | 6.25 |
| TPSA | 139.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.26 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|