C23H19Br2N7O2 — CID 135419784
2-[(E)-[[4-anilino-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dibromophenol (PubChem CID 135419784) has the molecular formula C23H19Br2N7O2 and a molecular weight of 585.26 g/mol. Its IUPAC name is 2-[(E)-[[4-anilino-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dibromophenol.
| Compound Name | 2-[(E)-[[4-anilino-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dibromophenol |
|---|---|
| PubChem CID | 135419784 |
| Molecular Formula | C23H19Br2N7O2 |
| Molecular Weight | 585.26 g/mol |
| Exact Mass | 583.00 |
| IUPAC Name | 2-[(E)-[[4-anilino-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dibromophenol |
| SMILES | COc1ccc(Nc2nc(N/N=C/c3cc(Br)cc(Br)c3O)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H19Br2N7O2/c1-34-18-9-7-17(8-10-18)28-22-29-21(27-16-5-3-2-4-6-16)30-23(31-22)32-26-13-14-11-15(24)12-19(25)20(14)33/h2-13,33H,1H3,(H3,27,28,29,30,31,32)/b26-13+ |
| InChIKey | HQNFNFXGUXYADN-LGJNPRDNSA-N |
| XLogP | 6.04 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.26 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|