C20H22BrN7O — CID 135615119
2-[(E)-[[4-anilino-6-(diethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-bromophenol (PubChem CID 135615119) has the molecular formula C20H22BrN7O and a molecular weight of 456.35 g/mol. Its IUPAC name is 2-[(E)-[[4-anilino-6-(diethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-bromophenol.
| Compound Name | 2-[(E)-[[4-anilino-6-(diethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-bromophenol |
|---|---|
| PubChem CID | 135615119 |
| Molecular Formula | C20H22BrN7O |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-[(E)-[[4-anilino-6-(diethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-bromophenol |
| SMILES | CCN(CC)c1nc(N/N=C/c2cc(Br)ccc2O)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C20H22BrN7O/c1-3-28(4-2)20-25-18(23-16-8-6-5-7-9-16)24-19(26-20)27-22-13-14-12-15(21)10-11-17(14)29/h5-13,29H,3-4H2,1-2H3,(H2,23,24,25,26,27)/b22-13+ |
| InChIKey | AAODCWQOHYTNNP-LPYMAVHISA-N |
| XLogP | 4.38 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|