C24H25N7O — CID 136833641
1-[(Z)-[[4-anilino-6-(diethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]naphthalen-2-ol (PubChem CID 136833641) has the molecular formula C24H25N7O and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-[(Z)-[[4-anilino-6-(diethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]naphthalen-2-ol.
| Compound Name | 1-[(Z)-[[4-anilino-6-(diethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 136833641 |
| Molecular Formula | C24H25N7O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 1-[(Z)-[[4-anilino-6-(diethylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]naphthalen-2-ol |
| SMILES | CCN(CC)c1nc(N/N=C\c2c(O)ccc3ccccc23)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C24H25N7O/c1-3-31(4-2)24-28-22(26-18-11-6-5-7-12-18)27-23(29-24)30-25-16-20-19-13-9-8-10-17(19)14-15-21(20)32/h5-16,32H,3-4H2,1-2H3,(H2,26,27,28,29,30)/b25-16- |
| InChIKey | FJMMTTSCQBKPGC-XYGWBWBKSA-N |
| XLogP | 4.77 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|