C29H24N4O3 — CID 3092892
1-[[[4-(3,4-dimethoxyphenyl)-6-phenylpyrimidin-2-yl]hydrazinylidene]methyl]naphthalen-2-ol (PubChem CID 3092892) has the molecular formula C29H24N4O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is 1-[[[4-(3,4-dimethoxyphenyl)-6-phenylpyrimidin-2-yl]hydrazinylidene]methyl]naphthalen-2-ol.
| Compound Name | 1-[[[4-(3,4-dimethoxyphenyl)-6-phenylpyrimidin-2-yl]hydrazinylidene]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 3092892 |
| Molecular Formula | C29H24N4O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 1-[[[4-(3,4-dimethoxyphenyl)-6-phenylpyrimidin-2-yl]hydrazinylidene]methyl]naphthalen-2-ol |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)nc(NN=Cc3c(O)ccc4ccccc34)n2)cc1OC |
| InChI | InChI=1S/C29H24N4O3/c1-35-27-15-13-21(16-28(27)36-2)25-17-24(20-9-4-3-5-10-20)31-29(32-25)33-30-18-23-22-11-7-6-8-19(22)12-14-26(23)34/h3-18,34H,1-2H3,(H,31,32,33) |
| InChIKey | ZAEMQCWOBJAQED-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|