C27H26N4O4 — CID 2842344
4-(3,4-dimethoxyphenyl)-N-[(2,4-dimethoxyphenyl)methylideneamino]-6-phenylpyrimidin-2-amine (PubChem CID 2842344) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-[(2,4-dimethoxyphenyl)methylideneamino]-6-phenylpyrimidin-2-amine.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-[(2,4-dimethoxyphenyl)methylideneamino]-6-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 2842344 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-[(2,4-dimethoxyphenyl)methylideneamino]-6-phenylpyrimidin-2-amine |
| SMILES | COc1ccc(C=NNc2nc(-c3ccccc3)cc(-c3ccc(OC)c(OC)c3)n2)c(OC)c1 |
| InChI | InChI=1S/C27H26N4O4/c1-32-21-12-10-20(25(15-21)34-3)17-28-31-27-29-22(18-8-6-5-7-9-18)16-23(30-27)19-11-13-24(33-2)26(14-19)35-4/h5-17H,1-4H3,(H,29,30,31) |
| InChIKey | XITYCSKVTOXTHH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|