C24H19BrN4O — CID 3092304
4-(4-bromophenyl)-N-[(4-methoxyphenyl)methylideneamino]-6-phenylpyrimidin-2-amine (PubChem CID 3092304) has the molecular formula C24H19BrN4O and a molecular weight of 459.35 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-[(4-methoxyphenyl)methylideneamino]-6-phenylpyrimidin-2-amine.
| Compound Name | 4-(4-bromophenyl)-N-[(4-methoxyphenyl)methylideneamino]-6-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 3092304 |
| Molecular Formula | C24H19BrN4O |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 4-(4-bromophenyl)-N-[(4-methoxyphenyl)methylideneamino]-6-phenylpyrimidin-2-amine |
| SMILES | COc1ccc(C=NNc2nc(-c3ccccc3)cc(-c3ccc(Br)cc3)n2)cc1 |
| InChI | InChI=1S/C24H19BrN4O/c1-30-21-13-7-17(8-14-21)16-26-29-24-27-22(18-5-3-2-4-6-18)15-23(28-24)19-9-11-20(25)12-10-19/h2-16H,1H3,(H,27,28,29) |
| InChIKey | UDPSOBKBYKVGLL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|