C23H16Br2N4O — CID 135421745
2-[6-(4-bromophenyl)-2-[(2E)-2-[(4-bromophenyl)methylidene]hydrazinyl]pyrimidin-4-yl]phenol (PubChem CID 135421745) has the molecular formula C23H16Br2N4O and a molecular weight of 524.22 g/mol. Its IUPAC name is 2-[6-(4-bromophenyl)-2-[(2E)-2-[(4-bromophenyl)methylidene]hydrazinyl]pyrimidin-4-yl]phenol.
| Compound Name | 2-[6-(4-bromophenyl)-2-[(2E)-2-[(4-bromophenyl)methylidene]hydrazinyl]pyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 135421745 |
| Molecular Formula | C23H16Br2N4O |
| Molecular Weight | 524.22 g/mol |
| Exact Mass | 521.97 |
| IUPAC Name | 2-[6-(4-bromophenyl)-2-[(2E)-2-[(4-bromophenyl)methylidene]hydrazinyl]pyrimidin-4-yl]phenol |
| SMILES | Oc1ccccc1-c1cc(-c2ccc(Br)cc2)nc(N/N=C/c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C23H16Br2N4O/c24-17-9-5-15(6-10-17)14-26-29-23-27-20(16-7-11-18(25)12-8-16)13-21(28-23)19-3-1-2-4-22(19)30/h1-14,30H,(H,27,28,29)/b26-14+ |
| InChIKey | PIANRDKPXSFNNY-VULFUBBASA-N |
| XLogP | 6.49 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.22 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|