C23H13F5N4O — CID 3092887
2-[2-[2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]-6-phenylpyrimidin-4-yl]phenol (PubChem CID 3092887) has the molecular formula C23H13F5N4O and a molecular weight of 456.37 g/mol. Its IUPAC name is 2-[2-[2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]-6-phenylpyrimidin-4-yl]phenol.
| Compound Name | 2-[2-[2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]-6-phenylpyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 3092887 |
| Molecular Formula | C23H13F5N4O |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 2-[2-[2-[(2,3,4,5,6-pentafluorophenyl)methylidene]hydrazinyl]-6-phenylpyrimidin-4-yl]phenol |
| SMILES | Oc1ccccc1-c1cc(-c2ccccc2)nc(NN=Cc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C23H13F5N4O/c24-18-14(19(25)21(27)22(28)20(18)26)11-29-32-23-30-15(12-6-2-1-3-7-12)10-16(31-23)13-8-4-5-9-17(13)33/h1-11,33H,(H,30,31,32) |
| InChIKey | ZEOUAURJEJLRIC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|