C23H13F5N4 — CID 5338887
N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]-4,6-diphenylpyrimidin-2-amine (PubChem CID 5338887) has the molecular formula C23H13F5N4 and a molecular weight of 440.38 g/mol. Its IUPAC name is N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]-4,6-diphenylpyrimidin-2-amine.
| Compound Name | N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]-4,6-diphenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 5338887 |
| Molecular Formula | C23H13F5N4 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]-4,6-diphenylpyrimidin-2-amine |
| SMILES | Fc1c(F)c(F)c(/C=N/Nc2nc(-c3ccccc3)cc(-c3ccccc3)n2)c(F)c1F |
| InChI | InChI=1S/C23H13F5N4/c24-18-15(19(25)21(27)22(28)20(18)26)12-29-32-23-30-16(13-7-3-1-4-8-13)11-17(31-23)14-9-5-2-6-10-14/h1-12H,(H,30,31,32)/b29-12+ |
| InChIKey | YVEFTAVSQOUNHO-XKJRVUDJSA-N |
| XLogP | 5.95 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|