C18H11F5N4 — CID 2842279
6-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]-2-phenylpyrimidin-4-amine (PubChem CID 2842279) has the molecular formula C18H11F5N4 and a molecular weight of 378.30 g/mol. Its IUPAC name is 6-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]-2-phenylpyrimidin-4-amine.
| Compound Name | 6-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]-2-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 2842279 |
| Molecular Formula | C18H11F5N4 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 6-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]-2-phenylpyrimidin-4-amine |
| SMILES | Cc1cc(NN=Cc2c(F)c(F)c(F)c(F)c2F)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H11F5N4/c1-9-7-12(26-18(25-9)10-5-3-2-4-6-10)27-24-8-11-13(19)15(21)17(23)16(22)14(11)20/h2-8H,1H3,(H,25,26,27) |
| InChIKey | UDDNIPXTYVMHOG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|