C23H17FN4 — CID 5332811
N-[(E)-(3-fluorophenyl)methylideneamino]-2,6-diphenylpyrimidin-4-amine (PubChem CID 5332811) has the molecular formula C23H17FN4 and a molecular weight of 368.42 g/mol. Its IUPAC name is N-[(E)-(3-fluorophenyl)methylideneamino]-2,6-diphenylpyrimidin-4-amine.
| Compound Name | N-[(E)-(3-fluorophenyl)methylideneamino]-2,6-diphenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 5332811 |
| Molecular Formula | C23H17FN4 |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[(E)-(3-fluorophenyl)methylideneamino]-2,6-diphenylpyrimidin-4-amine |
| SMILES | Fc1cccc(/C=N/Nc2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H17FN4/c24-20-13-7-8-17(14-20)16-25-28-22-15-21(18-9-3-1-4-10-18)26-23(27-22)19-11-5-2-6-12-19/h1-16H,(H,26,27,28)/b25-16+ |
| InChIKey | BZJBHNDEROHVMG-PCLIKHOPSA-N |
| XLogP | 5.40 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|