C13H9Cl2FN2 — CID 3622419
3,4-dichloro-N-[(3-fluorophenyl)methylideneamino]aniline (PubChem CID 3622419) has the molecular formula C13H9Cl2FN2 and a molecular weight of 283.13 g/mol. Its IUPAC name is 3,4-dichloro-N-[(3-fluorophenyl)methylideneamino]aniline.
| Compound Name | 3,4-dichloro-N-[(3-fluorophenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 3622419 |
| Molecular Formula | C13H9Cl2FN2 |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 3,4-dichloro-N-[(3-fluorophenyl)methylideneamino]aniline |
| SMILES | Fc1cccc(C=NNc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H9Cl2FN2/c14-12-5-4-11(7-13(12)15)18-17-8-9-2-1-3-10(16)6-9/h1-8,18H |
| InChIKey | GPAHTUDVCYTYMC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|