C13H9ClF2N2 — CID 5195808
N-[(3-chlorophenyl)methylideneamino]-2,4-difluoroaniline (PubChem CID 5195808) has the molecular formula C13H9ClF2N2 and a molecular weight of 266.68 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methylideneamino]-2,4-difluoroaniline.
| Compound Name | N-[(3-chlorophenyl)methylideneamino]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 5195808 |
| Molecular Formula | C13H9ClF2N2 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | N-[(3-chlorophenyl)methylideneamino]-2,4-difluoroaniline |
| SMILES | Fc1ccc(NN=Cc2cccc(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C13H9ClF2N2/c14-10-3-1-2-9(6-10)8-17-18-13-5-4-11(15)7-12(13)16/h1-8,18H |
| InChIKey | WGNVXQFCFOFEGW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|