C15H12F2N2 — CID 6903041
2,4-difluoro-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]aniline (PubChem CID 6903041) has the molecular formula C15H12F2N2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2,4-difluoro-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]aniline.
| Compound Name | 2,4-difluoro-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]aniline |
|---|---|
| PubChem CID | 6903041 |
| Molecular Formula | C15H12F2N2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2,4-difluoro-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]aniline |
| SMILES | Fc1ccc(N/N=C/C=C/c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C15H12F2N2/c16-13-8-9-15(14(17)11-13)19-18-10-4-7-12-5-2-1-3-6-12/h1-11,19H/b7-4+,18-10+ |
| InChIKey | QYWLVYZVXVHABE-UOMISXDJSA-N |
| XLogP | 4.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|