C26H22N6 — CID 92534193
4-N-[(E)-[(Z)-3-phenylprop-2-enylidene]amino]-1-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]phthalazine-1,4-diamine (PubChem CID 92534193) has the molecular formula C26H22N6 and a molecular weight of 418.50 g/mol. Its IUPAC name is 4-N-[(E)-[(Z)-3-phenylprop-2-enylidene]amino]-1-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]phthalazine-1,4-diamine.
| Compound Name | 4-N-[(E)-[(Z)-3-phenylprop-2-enylidene]amino]-1-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]phthalazine-1,4-diamine |
|---|---|
| PubChem CID | 92534193 |
| Molecular Formula | C26H22N6 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 4-N-[(E)-[(Z)-3-phenylprop-2-enylidene]amino]-1-N-[(E)-[(E)-3-phenylprop-2-enylidene]amino]phthalazine-1,4-diamine |
| SMILES | C(=C\c1ccccc1)\C=N\Nc1nnc(N/N=C/C=C/c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C26H22N6/c1-3-11-21(12-4-1)15-9-19-27-29-25-23-17-7-8-18-24(23)26(32-31-25)30-28-20-10-16-22-13-5-2-6-14-22/h1-20H,(H,29,31)(H,30,32)/b15-9-,16-10+,27-19+,28-20+ |
| InChIKey | AYTJSHHESVZMRL-RFOHKOFJSA-N |
| XLogP | 5.85 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|