C19H19N5 — CID 86279058
1,2-bis[(E)-[(E)-3-phenylprop-2-enylidene]amino]guanidine (PubChem CID 86279058) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is 1,2-bis[(E)-[(E)-3-phenylprop-2-enylidene]amino]guanidine.
| Compound Name | 1,2-bis[(E)-[(E)-3-phenylprop-2-enylidene]amino]guanidine |
|---|---|
| PubChem CID | 86279058 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1,2-bis[(E)-[(E)-3-phenylprop-2-enylidene]amino]guanidine |
| SMILES | N/C(=N\N=C\C=C\c1ccccc1)N/N=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H19N5/c20-19(23-21-15-7-13-17-9-3-1-4-10-17)24-22-16-8-14-18-11-5-2-6-12-18/h1-16H,(H3,20,23,24)/b13-7+,14-8+,21-15+,22-16+ |
| InChIKey | YNYUDLWQGGHJNY-AWKIKHLOSA-N |
| XLogP | 3.29 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_imine_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|