C15H15N5 — CID 98427762
1,2-bis[(E)-benzylideneamino]guanidine (PubChem CID 98427762) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is 1,2-bis[(E)-benzylideneamino]guanidine.
| Compound Name | 1,2-bis[(E)-benzylideneamino]guanidine |
|---|---|
| PubChem CID | 98427762 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1,2-bis[(E)-benzylideneamino]guanidine |
| SMILES | NC(=N/N=C/c1ccccc1)N/N=C/c1ccccc1 |
| InChI | InChI=1S/C15H15N5/c16-15(19-17-11-13-7-3-1-4-8-13)20-18-12-14-9-5-2-6-10-14/h1-12H,(H3,16,19,20)/b17-11+,18-12+ |
| InChIKey | ZWLXITGRGUNARS-JYFOCSDGSA-N |
| XLogP | 1.96 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|