C15H13Br2N5 — CID 6778167
1,2-bis[(Z)-(4-bromophenyl)methylideneamino]guanidine (PubChem CID 6778167) has the molecular formula C15H13Br2N5 and a molecular weight of 423.11 g/mol. Its IUPAC name is 1,2-bis[(Z)-(4-bromophenyl)methylideneamino]guanidine.
| Compound Name | 1,2-bis[(Z)-(4-bromophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 6778167 |
| Molecular Formula | C15H13Br2N5 |
| Molecular Weight | 423.11 g/mol |
| Exact Mass | 420.95 |
| IUPAC Name | 1,2-bis[(Z)-(4-bromophenyl)methylideneamino]guanidine |
| SMILES | NC(=N/N=C\c1ccc(Br)cc1)N/N=C\c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H13Br2N5/c16-13-5-1-11(2-6-13)9-19-21-15(18)22-20-10-12-3-7-14(17)8-4-12/h1-10H,(H3,18,21,22)/b19-9-,20-10- |
| InChIKey | GGHXKKZQNZZKCW-QJUDHZBZSA-N |
| XLogP | 3.48 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.11 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|