C16H14Br2N6 — CID 21497963
2-[(E)-(4-bromophenyl)methylideneamino]-1-[(E)-(4-cyanophenyl)methylideneamino]guanidine;hydrobromide (PubChem CID 21497963) has the molecular formula C16H14Br2N6 and a molecular weight of 450.14 g/mol. Its IUPAC name is 2-[(E)-(4-bromophenyl)methylideneamino]-1-[(E)-(4-cyanophenyl)methylideneamino]guanidine;hydrobromide.
| Compound Name | 2-[(E)-(4-bromophenyl)methylideneamino]-1-[(E)-(4-cyanophenyl)methylideneamino]guanidine;hydrobromide |
|---|---|
| PubChem CID | 21497963 |
| Molecular Formula | C16H14Br2N6 |
| Molecular Weight | 450.14 g/mol |
| Exact Mass | 447.96 |
| IUPAC Name | 2-[(E)-(4-bromophenyl)methylideneamino]-1-[(E)-(4-cyanophenyl)methylideneamino]guanidine;hydrobromide |
| SMILES | Br.N#Cc1ccc(/C=N/N/C(N)=N\N=C\c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H13BrN6.BrH/c17-15-7-5-14(6-8-15)11-21-23-16(19)22-20-10-13-3-1-12(9-18)2-4-13;/h1-8,10-11H,(H3,19,22,23);1H/b20-10+,21-11+; |
| InChIKey | DMHOIWVZGHCEDC-CUBOLJEZSA-N |
| XLogP | 3.17 |
| TPSA | 98.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|